About 3,5-diethyl-1,2,4-triazolidine
3,5-diethyl-1,2,4-triazolidine (PubChem CID 68573592) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is 3,5-diethyl-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 3,5-diethyl-1,2,4-triazolidine |
| PubChem CID | 68573592 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 3,5-diethyl-1,2,4-triazolidine |
| SMILES | CCC1NNC(CC)N1 |
| InChI | InChI=1S/C6H15N3/c1-3-5-7-6(4-2)9-8-5/h5-9H,3-4H2,1-2H3 |
| InChIKey | NGKTUVMCHMOILW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diethyl-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-1,2,4-triazolidine?
The IUPAC name of 3,5-diethyl-1,2,4-triazolidine (CID 68573592) is 3,5-diethyl-1,2,4-triazolidine.
What is the SMILES notation for 3,5-diethyl-1,2,4-triazolidine?
The canonical SMILES for 3,5-diethyl-1,2,4-triazolidine is CCC1NNC(CC)N1.
What is the InChIKey of 3,5-diethyl-1,2,4-triazolidine?
The InChIKey is NGKTUVMCHMOILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3/c1-3-5-7-6(4-2)9-8-5/h5-9H,3-4H2,1-2H3.
What are the key properties of 3,5-diethyl-1,2,4-triazolidine?
3,5-diethyl-1,2,4-triazolidine has a molecular weight of 129.21 g/mol, XLogP of 0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1,2,4-triazolidine is sourced from PubChem (CID 68573592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).