About (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate
(2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate (PubChem CID 68573821) has the molecular formula C14H19ClN4O3
and a molecular weight of 326.78 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate |
| PubChem CID | 68573821 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate |
| SMILES | NC(=O)COC(=O)NCC1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H19ClN4O3/c15-11-1-2-13(17-8-11)19-5-3-10(4-6-19)7-18-14(21)22-9-12(16)20/h1-2,8,10H,3-7,9H2,(H2,16,20)(H,18,21) |
| InChIKey | YDJONUFUVPTFNH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate?
The IUPAC name of (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate (CID 68573821) is (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate.
What is the SMILES notation for (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate?
The canonical SMILES for (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate is NC(=O)COC(=O)NCC1CCN(c2ccc(Cl)cn2)CC1.
What is the InChIKey of (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate?
The InChIKey is YDJONUFUVPTFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4O3/c15-11-1-2-13(17-8-11)19-5-3-10(4-6-19)7-18-14(21)22-9-12(16)20/h1-2,8,10H,3-7,9H2,(H2,16,20)(H,18,21).
What are the key properties of (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate?
(2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate has a molecular weight of 326.78 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) N-[[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methyl]carbamate is sourced from PubChem (CID 68573821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).