C21H42N4O — CID 68573955
cyclohexanamine;N-[4-(4-propan-2-ylpiperazin-1-yl)cyclohexyl]acetamide (PubChem CID 68573955) has the molecular formula C21H42N4O and a molecular weight of 366.59 g/mol. Its IUPAC name is cyclohexanamine;N-[4-(4-propan-2-ylpiperazin-1-yl)cyclohexyl]acetamide.
| Compound Name | cyclohexanamine;N-[4-(4-propan-2-ylpiperazin-1-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 68573955 |
| Molecular Formula | C21H42N4O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | cyclohexanamine;N-[4-(4-propan-2-ylpiperazin-1-yl)cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(N2CCN(C(C)C)CC2)CC1.NC1CCCCC1 |
| InChI | InChI=1S/C15H29N3O.C6H13N/c1-12(2)17-8-10-18(11-9-17)15-6-4-14(5-7-15)16-13(3)19;7-6-4-2-1-3-5-6/h12,14-15H,4-11H2,1-3H3,(H,16,19);6H,1-5,7H2 |
| InChIKey | OLHYAQXDTRLXEA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |