C18H18N5S+ — CID 68574052
2-(3,5-diphenyl-1H-tetrazol-2-yl)-4,5-dimethyl-1,3-thiazol-3-ium (PubChem CID 68574052) has the molecular formula C18H18N5S+ and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-(3,5-diphenyl-1H-tetrazol-2-yl)-4,5-dimethyl-1,3-thiazol-3-ium.
| Compound Name | 2-(3,5-diphenyl-1H-tetrazol-2-yl)-4,5-dimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 68574052 |
| Molecular Formula | C18H18N5S+ |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(3,5-diphenyl-1H-tetrazol-2-yl)-4,5-dimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1[nH+]c(N2NC(c3ccccc3)=NN2c2ccccc2)sc1C |
| InChI | InChI=1S/C18H17N5S/c1-13-14(2)24-18(19-13)23-21-17(15-9-5-3-6-10-15)20-22(23)16-11-7-4-8-12-16/h3-12H,1-2H3,(H,20,21)/p+1 |
| InChIKey | ASJSXUWOFZATJM-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |