C14H20NO6P — CID 68574132
(2R,4R)-2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 68574132) has the molecular formula C14H20NO6P and a molecular weight of 329.29 g/mol. Its IUPAC name is (2R,4R)-2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2R,4R)-2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 68574132 |
| Molecular Formula | C14H20NO6P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2R,4R)-2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCCCC[C@@H]1CCO[P@@](=O)(Oc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C14H20NO6P/c1-2-3-4-5-13-10-11-19-22(18,20-13)21-14-8-6-12(7-9-14)15(16)17/h6-9,13H,2-5,10-11H2,1H3/t13-,22-/m1/s1 |
| InChIKey | KJNSEFQJLYEOJN-MCMMXHMISA-N |
| XLogP | 4.47 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|