hydrogen arsorite

HAsO3-2 — CID 6857430

IUPAChydrogen arsorite
SMILES[O-][As]([O-])O
InChIInChI=1S/AsHO3/c2-1(3)4/h2H/q-2
InChIKeyRJFGWSIMCQVVJS-UHFFFAOYSA-N
MW123.93 g/mol
LogP-3.32
Rot. Bonds

About hydrogen arsorite

hydrogen arsorite (PubChem CID 6857430) has the molecular formula HAsO3-2 and a molecular weight of 123.93 g/mol. Its IUPAC name is hydrogen arsorite.

Molecular Properties

Compound Namehydrogen arsorite
PubChem CID6857430
Molecular FormulaHAsO3-2
Molecular Weight123.93 g/mol
Exact Mass123.92
IUPAC Namehydrogen arsorite
SMILES[O-][As]([O-])O
InChIInChI=1S/AsHO3/c2-1(3)4/h2H/q-2
InChIKeyRJFGWSIMCQVVJS-UHFFFAOYSA-N
XLogP-3.32
TPSA66.35 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500123.93
LogP ≤ 5-3.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze hydrogen arsorite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen arsorite?
The IUPAC name of hydrogen arsorite (CID 6857430) is hydrogen arsorite.
What is the SMILES notation for hydrogen arsorite?
The canonical SMILES for hydrogen arsorite is [O-][As]([O-])O.
What is the InChIKey of hydrogen arsorite?
The InChIKey is RJFGWSIMCQVVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/AsHO3/c2-1(3)4/h2H/q-2.
What are the key properties of hydrogen arsorite?
hydrogen arsorite has a molecular weight of 123.93 g/mol, XLogP of -3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen arsorite is sourced from PubChem (CID 6857430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).