About 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one
6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 6857433) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 6857433 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | O=C1NC=CC2NC=CN12 |
| InChI | InChI=1S/C6H7N3O/c10-6-8-2-1-5-7-3-4-9(5)6/h1-5,7H,(H,8,10) |
| InChIKey | WFYBZSUHXJBDMM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one (CID 6857433) is 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one is O=C1NC=CC2NC=CN12.
What is the InChIKey of 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
The InChIKey is WFYBZSUHXJBDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c10-6-8-2-1-5-7-3-4-9(5)6/h1-5,7H,(H,8,10).
What are the key properties of 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one?
6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one has a molecular weight of 137.14 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8a-dihydro-1H-imidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 6857433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).