C17H15Cl2F3O4 — CID 68574440
3-(2,4-dichlorophenyl)-8-(2,2,2-trifluoroethoxy)-1-oxaspiro[4.5]decane-2,4-dione (PubChem CID 68574440) has the molecular formula C17H15Cl2F3O4 and a molecular weight of 411.20 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-8-(2,2,2-trifluoroethoxy)-1-oxaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-8-(2,2,2-trifluoroethoxy)-1-oxaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 68574440 |
| Molecular Formula | C17H15Cl2F3O4 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-8-(2,2,2-trifluoroethoxy)-1-oxaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1OC2(CCC(OCC(F)(F)F)CC2)C(=O)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2F3O4/c18-9-1-2-11(12(19)7-9)13-14(23)16(26-15(13)24)5-3-10(4-6-16)25-8-17(20,21)22/h1-2,7,10,13H,3-6,8H2 |
| InChIKey | QJHUYOHDBXJQLG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|