About 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide
3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide (PubChem CID 68574507) has the molecular formula C25H26N2O3
and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide.
Molecular Properties
| Compound Name | 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide |
| PubChem CID | 68574507 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)c(Cc2ccccc2)c1)C1NCC(O)C1O |
| InChI | InChI=1S/C25H26N2O3/c1-27(24-23(29)22(28)16-26-24)25(30)19-12-13-21(18-10-6-3-7-11-18)20(15-19)14-17-8-4-2-5-9-17/h2-13,15,22-24,26,28-29H,14,16H2,1H3 |
| InChIKey | HEHCRUILHPYCGY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide?
The IUPAC name of 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide (CID 68574507) is 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide.
What is the SMILES notation for 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide?
The canonical SMILES for 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide is CN(C(=O)c1ccc(-c2ccccc2)c(Cc2ccccc2)c1)C1NCC(O)C1O.
What is the InChIKey of 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide?
The InChIKey is HEHCRUILHPYCGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O3/c1-27(24-23(29)22(28)16-26-24)25(30)19-12-13-21(18-10-6-3-7-11-18)20(15-19)14-17-8-4-2-5-9-17/h2-13,15,22-24,26,28-29H,14,16H2,1H3.
What are the key properties of 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide?
3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide has a molecular weight of 402.49 g/mol, XLogP of 2.67, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N-(3,4-dihydroxypyrrolidin-2-yl)-N-methyl-4-phenylbenzamide is sourced from PubChem (CID 68574507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).