C19H27ClN4O4S — CID 68574574
(E)-but-2-enedioic acid;N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 68574574) has the molecular formula C19H27ClN4O4S and a molecular weight of 442.97 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 68574574 |
| Molecular Formula | C19H27ClN4O4S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | CC(C)CN(Cc1c(Cl)nc2sccn12)C1CCNCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H23ClN4S.C4H4O4/c1-11(2)9-19(12-3-5-17-6-4-12)10-13-14(16)18-15-20(13)7-8-21-15;5-3(6)1-2-4(7)8/h7-8,11-12,17H,3-6,9-10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WREPINFDXHUHOW-WLHGVMLRSA-N |
| XLogP | 2.97 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|