About but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine
but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine (PubChem CID 68574805) has the molecular formula C19H30N2O4S
and a molecular weight of 382.53 g/mol. Its IUPAC name is but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine |
| PubChem CID | 68574805 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine |
| SMILES | Cc1ccsc1CN(CC(C)C)C1CCNCC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H26N2S.C4H4O4/c1-12(2)10-17(14-4-7-16-8-5-14)11-15-13(3)6-9-18-15;5-3(6)1-2-4(7)8/h6,9,12,14,16H,4-5,7-8,10-11H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RCRMCGFJSYQIGS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine?
The IUPAC name of but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine (CID 68574805) is but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine.
What is the SMILES notation for but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine?
The canonical SMILES for but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine is Cc1ccsc1CN(CC(C)C)C1CCNCC1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine?
The InChIKey is RCRMCGFJSYQIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2S.C4H4O4/c1-12(2)10-17(14-4-7-16-8-5-14)11-15-13(3)6-9-18-15;5-3(6)1-2-4(7)8/h6,9,12,14,16H,4-5,7-8,10-11H2,1-3H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine?
but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine has a molecular weight of 382.53 g/mol, XLogP of 2.98, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 68574805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).