About 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate
5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate (PubChem CID 68574949) has the molecular formula C25H38O5
and a molecular weight of 418.57 g/mol. Its IUPAC name is 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate |
| PubChem CID | 68574949 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC1=C(CCCCOC(=O)C(=C)C)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C25H38O5/c1-18(2)23(27)29-14-10-7-8-12-20-16-25(5,6)17-22(26)21(20)13-9-11-15-30-24(28)19(3)4/h1,3,7-17H2,2,4-6H3 |
| InChIKey | KFBSWFMMJFCQJC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate?
The IUPAC name of 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate (CID 68574949) is 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate.
What is the SMILES notation for 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate?
The canonical SMILES for 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCCC1=C(CCCCOC(=O)C(=C)C)C(=O)CC(C)(C)C1.
What is the InChIKey of 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate?
The InChIKey is KFBSWFMMJFCQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38O5/c1-18(2)23(27)29-14-10-7-8-12-20-16-25(5,6)17-22(26)21(20)13-9-11-15-30-24(28)19(3)4/h1,3,7-17H2,2,4-6H3.
What are the key properties of 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate?
5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate has a molecular weight of 418.57 g/mol, XLogP of 5.64, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5,5-dimethyl-2-[4-(2-methylprop-2-enoyloxy)butyl]-3-oxocyclohexen-1-yl]pentyl 2-methylprop-2-enoate is sourced from PubChem (CID 68574949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).