C21H40O6 — CID 68575200
4,5,6-tributoxy-2-prop-2-enoxycyclohexane-1,3-diol (PubChem CID 68575200) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4,5,6-tributoxy-2-prop-2-enoxycyclohexane-1,3-diol.
| Compound Name | 4,5,6-tributoxy-2-prop-2-enoxycyclohexane-1,3-diol |
|---|---|
| PubChem CID | 68575200 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 4,5,6-tributoxy-2-prop-2-enoxycyclohexane-1,3-diol |
| SMILES | C=CCOC1C(O)C(OCCCC)C(OCCCC)C(OCCCC)C1O |
| InChI | InChI=1S/C21H40O6/c1-5-9-13-25-19-16(22)18(24-12-8-4)17(23)20(26-14-10-6-2)21(19)27-15-11-7-3/h8,16-23H,4-7,9-15H2,1-3H3 |
| InChIKey | ULFVBCAWFWPVFO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|