C17H25Cl2N3O4S — CID 68575218
but-2-enedioic acid;N-[(2,4-dichloro-1,3-thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 68575218) has the molecular formula C17H25Cl2N3O4S and a molecular weight of 438.38 g/mol. Its IUPAC name is but-2-enedioic acid;N-[(2,4-dichloro-1,3-thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | but-2-enedioic acid;N-[(2,4-dichloro-1,3-thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 68575218 |
| Molecular Formula | C17H25Cl2N3O4S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | but-2-enedioic acid;N-[(2,4-dichloro-1,3-thiazol-5-yl)methyl]-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | CC(C)CN(Cc1sc(Cl)nc1Cl)C1CCNCC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H21Cl2N3S.C4H4O4/c1-9(2)7-18(10-3-5-16-6-4-10)8-11-12(14)17-13(15)19-11;5-3(6)1-2-4(7)8/h9-10,16H,3-8H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | AOIPYURFPWQSFS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|