C33H37N3O3 — CID 68575617
N-[(1R,2S)-2-[(3aR,4S,9bR)-4-(phenylmethoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide (PubChem CID 68575617) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aR,4S,9bR)-4-(phenylmethoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide.
| Compound Name | N-[(1R,2S)-2-[(3aR,4S,9bR)-4-(phenylmethoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 68575617 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | N-[(1R,2S)-2-[(3aR,4S,9bR)-4-(phenylmethoxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@@H]2[C@@H](COCc3ccccc3)Nc3ccccc3[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O3/c37-32(24-13-5-2-6-14-24)35-29-18-10-8-16-27(29)33(38)36-20-19-26-30(22-39-21-23-11-3-1-4-12-23)34-28-17-9-7-15-25(28)31(26)36/h1-7,9,11-15,17,26-27,29-31,34H,8,10,16,18-22H2,(H,35,37)/t26-,27+,29-,30-,31+/m1/s1 |
| InChIKey | UZSVNNWKYBKUIV-LHPPWQBVSA-N |
| XLogP | 5.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |