C27H32F3N5O — CID 68575634
(4,6-dimethylpyrimidin-5-yl)-[5-[3-phenyl-3-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]propyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone (PubChem CID 68575634) has the molecular formula C27H32F3N5O and a molecular weight of 499.58 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-5-yl)-[5-[3-phenyl-3-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]propyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone.
| Compound Name | (4,6-dimethylpyrimidin-5-yl)-[5-[3-phenyl-3-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]propyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 68575634 |
| Molecular Formula | C27H32F3N5O |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (4,6-dimethylpyrimidin-5-yl)-[5-[3-phenyl-3-[1-(2,2,2-trifluoroethyl)azetidin-3-yl]propyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2=CN(CCC(c3ccccc3)C3CN(CC(F)(F)F)C3)CC2C1 |
| InChI | InChI=1S/C27H32F3N5O/c1-18-25(19(2)32-17-31-18)26(36)35-14-21-10-33(11-22(21)15-35)9-8-24(20-6-4-3-5-7-20)23-12-34(13-23)16-27(28,29)30/h3-7,10,17,22-24H,8-9,11-16H2,1-2H3 |
| InChIKey | KKTOMTCSHYBBMO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |