About 22,23-dihydro-21H-corrin
22,23-dihydro-21H-corrin (PubChem CID 6857582) has the molecular formula C19H14N4
and a molecular weight of 298.35 g/mol. Its IUPAC name is 22,23-dihydro-21H-corrin.
Molecular Properties
| Compound Name | 22,23-dihydro-21H-corrin |
| PubChem CID | 6857582 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 22,23-dihydro-21H-corrin |
| SMILES | C1=Cc2nc1cc1ccc(cc3ccc(cc4ccc2[nH]4)[nH]3)[nH]1 |
| InChI | InChI=1S/C19H14N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h1-11,20-22H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,19-18- |
| InChIKey | LYNARWYQOUZXDY-MXCYJBDUSA-N |
| XLogP | 4.70 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 22,23-dihydro-21H-corrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 22,23-dihydro-21H-corrin?
The IUPAC name of 22,23-dihydro-21H-corrin (CID 6857582) is 22,23-dihydro-21H-corrin.
What is the SMILES notation for 22,23-dihydro-21H-corrin?
The canonical SMILES for 22,23-dihydro-21H-corrin is C1=Cc2nc1cc1ccc(cc3ccc(cc4ccc2[nH]4)[nH]3)[nH]1.
What is the InChIKey of 22,23-dihydro-21H-corrin?
The InChIKey is LYNARWYQOUZXDY-MXCYJBDUSA-N. The full InChI is InChI=1S/C19H14N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h1-11,20-22H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,19-18-.
What are the key properties of 22,23-dihydro-21H-corrin?
22,23-dihydro-21H-corrin has a molecular weight of 298.35 g/mol, XLogP of 4.70, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 22,23-dihydro-21H-corrin is sourced from PubChem (CID 6857582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).