About 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione
8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione (PubChem CID 68575867) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione |
| PubChem CID | 68575867 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione |
| SMILES | C=C/N=C1\CCCC2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C12H11NO2/c1-2-13-9-5-3-4-8-10(14)6-7-11(15)12(8)9/h2,6-7H,1,3-5H2/b13-9+ |
| InChIKey | FBPNAUBKGLCQFG-UKTHLTGXSA-N |
| XLogP | 1.76 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione?
The IUPAC name of 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione (CID 68575867) is 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione.
What is the SMILES notation for 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione?
The canonical SMILES for 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione is C=C/N=C1\CCCC2=C1C(=O)C=CC2=O.
What is the InChIKey of 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione?
The InChIKey is FBPNAUBKGLCQFG-UKTHLTGXSA-N. The full InChI is InChI=1S/C12H11NO2/c1-2-13-9-5-3-4-8-10(14)6-7-11(15)12(8)9/h2,6-7H,1,3-5H2/b13-9+.
What are the key properties of 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione?
8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione has a molecular weight of 201.22 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenylimino-6,7-dihydro-5H-naphthalene-1,4-dione is sourced from PubChem (CID 68575867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).