About dichloroosmium;bis(2-pyridin-2-ylpyridine)
dichloroosmium;bis(2-pyridin-2-ylpyridine) (PubChem CID 6857603) has the molecular formula C20H16Cl2N4Os
and a molecular weight of 573.51 g/mol. Its IUPAC name is dichloroosmium;bis(2-pyridin-2-ylpyridine).
Molecular Properties
| Compound Name | dichloroosmium;bis(2-pyridin-2-ylpyridine) |
| PubChem CID | 6857603 |
| Molecular Formula | C20H16Cl2N4Os |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | dichloroosmium;bis(2-pyridin-2-ylpyridine) |
| SMILES | Cl[Os]Cl.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/2C10H8N2.2ClH.Os/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h2*1-8H;2*1H;/q;;;;+2/p-2 |
| InChIKey | SYYZASDJJIWDME-UHFFFAOYSA-L |
| XLogP | 5.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichloroosmium;bis(2-pyridin-2-ylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroosmium;bis(2-pyridin-2-ylpyridine)?
The IUPAC name of dichloroosmium;bis(2-pyridin-2-ylpyridine) (CID 6857603) is dichloroosmium;bis(2-pyridin-2-ylpyridine).
What is the SMILES notation for dichloroosmium;bis(2-pyridin-2-ylpyridine)?
The canonical SMILES for dichloroosmium;bis(2-pyridin-2-ylpyridine) is Cl[Os]Cl.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of dichloroosmium;bis(2-pyridin-2-ylpyridine)?
The InChIKey is SYYZASDJJIWDME-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H8N2.2ClH.Os/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h2*1-8H;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroosmium;bis(2-pyridin-2-ylpyridine)?
dichloroosmium;bis(2-pyridin-2-ylpyridine) has a molecular weight of 573.51 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroosmium;bis(2-pyridin-2-ylpyridine) is sourced from PubChem (CID 6857603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).