About (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate
(2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate (PubChem CID 68576673) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate |
| PubChem CID | 68576673 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate |
| SMILES | CCOC(=O)COC(=O)C(C)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C15H26O4/c1-5-18-13(16)10-19-14(17)11(2)12-7-6-8-15(3,4)9-12/h11-12H,5-10H2,1-4H3 |
| InChIKey | SFDDJGIMHONNHU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate (CID 68576673) is (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate is CCOC(=O)COC(=O)C(C)C1CCCC(C)(C)C1.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate?
The InChIKey is SFDDJGIMHONNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O4/c1-5-18-13(16)10-19-14(17)11(2)12-7-6-8-15(3,4)9-12/h11-12H,5-10H2,1-4H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate?
(2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate has a molecular weight of 270.37 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 2-(3,3-dimethylcyclohexyl)propanoate is sourced from PubChem (CID 68576673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).