C22H27ClN6O4S — CID 6857700
(2S)-2-[[2-(3-chlorophenyl)-2-oxoacetyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-methylbutanamide (PubChem CID 6857700) has the molecular formula C22H27ClN6O4S and a molecular weight of 507.02 g/mol. Its IUPAC name is (2S)-2-[[2-(3-chlorophenyl)-2-oxoacetyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[2-(3-chlorophenyl)-2-oxoacetyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 6857700 |
| Molecular Formula | C22H27ClN6O4S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (2S)-2-[[2-(3-chlorophenyl)-2-oxoacetyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)C(=O)c1cccc(Cl)c1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nccs1 |
| InChI | InChI=1S/C22H27ClN6O4S/c1-12(2)16(29-20(33)17(30)13-5-3-6-14(23)11-13)19(32)28-15(7-4-8-27-22(24)25)18(31)21-26-9-10-34-21/h3,5-6,9-12,15-16H,4,7-8H2,1-2H3,(H,28,32)(H,29,33)(H4,24,25,27)/t15-,16-/m0/s1 |
| InChIKey | NZMZDRVEUJTADA-HOTGVXAUSA-N |
| XLogP | 1.54 |
| TPSA | 169.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|