C18H16N2O3 — CID 68577084
N,N-dimethylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-carboxamide (PubChem CID 68577084) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is N,N-dimethylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-carboxamide.
| Compound Name | N,N-dimethylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-carboxamide |
|---|---|
| PubChem CID | 68577084 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N,N-dimethylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)C1(COC=N1)c1ccccc1O2 |
| InChI | InChI=1S/C18H16N2O3/c1-20(2)17(21)12-7-8-16-14(9-12)18(10-22-11-19-18)13-5-3-4-6-15(13)23-16/h3-9,11H,10H2,1-2H3 |
| InChIKey | ZTWCIBACCZJFCP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |