C21H27NO7 — CID 68577320
5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,3R,4S,6S,7S)-3-methyl-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate (PubChem CID 68577320) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,3R,4S,6S,7S)-3-methyl-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate.
| Compound Name | 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,3R,4S,6S,7S)-3-methyl-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
|---|---|
| PubChem CID | 68577320 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,3R,4S,6S,7S)-3-methyl-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)O[C@@H]2[C@@H](C(=O)OC(C)(C)C)[C@@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO7/c1-12-15(19(24)26-5)22(20(25)27-11-13-9-7-6-8-10-13)16-14(17(16)28-12)18(23)29-21(2,3)4/h6-10,12,14-17H,11H2,1-5H3/t12-,14+,15+,16+,17-/m1/s1 |
| InChIKey | ACMSPFIBJMZZGA-YYESSZKYSA-N |
| XLogP | 2.29 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|