C22H24N2O6 — CID 68577473
(2R)-3-oxo-3-phenylmethoxy-2-[phenylmethoxycarbonyl(pyrrolidin-3-yl)amino]propanoic acid (PubChem CID 68577473) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2R)-3-oxo-3-phenylmethoxy-2-[phenylmethoxycarbonyl(pyrrolidin-3-yl)amino]propanoic acid.
| Compound Name | (2R)-3-oxo-3-phenylmethoxy-2-[phenylmethoxycarbonyl(pyrrolidin-3-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 68577473 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2R)-3-oxo-3-phenylmethoxy-2-[phenylmethoxycarbonyl(pyrrolidin-3-yl)amino]propanoic acid |
| SMILES | O=C(O)[C@H](C(=O)OCc1ccccc1)N(C(=O)OCc1ccccc1)C1CCNC1 |
| InChI | InChI=1S/C22H24N2O6/c25-20(26)19(21(27)29-14-16-7-3-1-4-8-16)24(18-11-12-23-13-18)22(28)30-15-17-9-5-2-6-10-17/h1-10,18-19,23H,11-15H2,(H,25,26)/t18?,19-/m1/s1 |
| InChIKey | GCWGAVBMZNQCDV-MUMRKEEXSA-N |
| XLogP | 2.18 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|