About (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one
(5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one (PubChem CID 6857764) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one.
Molecular Properties
| Compound Name | (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one |
| PubChem CID | 6857764 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one |
| SMILES | C/C1=C\CCC(=O)C2CC(C)(C)C2CC1 |
| InChI | InChI=1S/C14H22O/c1-10-5-4-6-13(15)11-9-14(2,3)12(11)8-7-10/h5,11-12H,4,6-9H2,1-3H3/b10-5+ |
| InChIKey | MBZBBVTYLUNZPJ-BJMVGYQFSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one?
The IUPAC name of (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one (CID 6857764) is (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one.
What is the SMILES notation for (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one?
The canonical SMILES for (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one is C/C1=C\CCC(=O)C2CC(C)(C)C2CC1.
What is the InChIKey of (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one?
The InChIKey is MBZBBVTYLUNZPJ-BJMVGYQFSA-N. The full InChI is InChI=1S/C14H22O/c1-10-5-4-6-13(15)11-9-14(2,3)12(11)8-7-10/h5,11-12H,4,6-9H2,1-3H3/b10-5+.
What are the key properties of (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one?
(5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one has a molecular weight of 206.33 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one is sourced from PubChem (CID 6857764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).