C35H35N7O2 — CID 68577717
7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(2-pyridin-3-ylethyl)-1H-quinoxaline-2,3-dione (PubChem CID 68577717) has the molecular formula C35H35N7O2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(2-pyridin-3-ylethyl)-1H-quinoxaline-2,3-dione.
| Compound Name | 7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(2-pyridin-3-ylethyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 68577717 |
| Molecular Formula | C35H35N7O2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(2-pyridin-3-ylethyl)-1H-quinoxaline-2,3-dione |
| SMILES | CCc1ccc(-c2nc3c(N4CCN(Cc5ccc6c(c5)[nH]c(=O)c(=O)n6CCc5cccnc5)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C35H35N7O2/c1-2-24-8-11-27(12-9-24)33-37-28-6-3-7-31(32(28)39-33)41-19-17-40(18-20-41)23-26-10-13-30-29(21-26)38-34(43)35(44)42(30)16-14-25-5-4-15-36-22-25/h3-13,15,21-22H,2,14,16-20,23H2,1H3,(H,37,39)(H,38,43) |
| InChIKey | RJPXBTMRIWXELM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|