C23H38N2O3 — CID 68578158
1-[4-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine (PubChem CID 68578158) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is 1-[4-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 68578158 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 1-[4-[4-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine |
| SMILES | C[C@@H]1CN(CCCOc2ccc(C3(CN(C)C)CCOCC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H38N2O3/c1-19-16-25(17-20(2)28-19)12-5-13-27-22-8-6-21(7-9-22)23(18-24(3)4)10-14-26-15-11-23/h6-9,19-20H,5,10-18H2,1-4H3/t19-,20+ |
| InChIKey | QPUUPBFXMNJVQC-BGYRXZFFSA-N |
| XLogP | 3.17 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|