C31H34N6O2 — CID 68578299
6-[[(2R)-4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]-2-methylpiperazin-1-yl]methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 68578299) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 6-[[(2R)-4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]-2-methylpiperazin-1-yl]methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[[(2R)-4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]-2-methylpiperazin-1-yl]methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 68578299 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 6-[[(2R)-4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]-2-methylpiperazin-1-yl]methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | C[C@@H]1CN(c2cccc3[nH]c(-c4ccc(C(C)(C)C)cc4)nc23)CCN1Cc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C31H34N6O2/c1-19-17-37(15-14-36(19)18-20-8-13-23-25(16-20)34-30(39)29(38)33-23)26-7-5-6-24-27(26)35-28(32-24)21-9-11-22(12-10-21)31(2,3)4/h5-13,16,19H,14-15,17-18H2,1-4H3,(H,32,35)(H,33,38)(H,34,39)/t19-/m1/s1 |
| InChIKey | OHKAYPMYDDMXQG-LJQANCHMSA-N |
| XLogP | 4.77 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|