About 10-methoxy-15-phenyl-21,22-dihydroporphyrin
10-methoxy-15-phenyl-21,22-dihydroporphyrin (PubChem CID 68578434) has the molecular formula C27H20N4O
and a molecular weight of 416.48 g/mol. Its IUPAC name is 10-methoxy-15-phenyl-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 10-methoxy-15-phenyl-21,22-dihydroporphyrin |
| PubChem CID | 68578434 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 10-methoxy-15-phenyl-21,22-dihydroporphyrin |
| SMILES | COc1c2nc(c(-c3ccccc3)c3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C27H20N4O/c1-32-27-24-12-10-21(30-24)16-19-8-7-18(28-19)15-20-9-11-22(29-20)26(17-5-3-2-4-6-17)23-13-14-25(27)31-23/h2-16,28,30H,1H3/b18-15-,19-16-,20-15-,21-16-,26-22-,26-23-,27-24+,27-25+ |
| InChIKey | KQZDPZBQJXAYGO-OKQFWJMGSA-N |
| XLogP | 6.33 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-methoxy-15-phenyl-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-15-phenyl-21,22-dihydroporphyrin?
The IUPAC name of 10-methoxy-15-phenyl-21,22-dihydroporphyrin (CID 68578434) is 10-methoxy-15-phenyl-21,22-dihydroporphyrin.
What is the SMILES notation for 10-methoxy-15-phenyl-21,22-dihydroporphyrin?
The canonical SMILES for 10-methoxy-15-phenyl-21,22-dihydroporphyrin is COc1c2nc(c(-c3ccccc3)c3nc(cc4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2.
What is the InChIKey of 10-methoxy-15-phenyl-21,22-dihydroporphyrin?
The InChIKey is KQZDPZBQJXAYGO-OKQFWJMGSA-N. The full InChI is InChI=1S/C27H20N4O/c1-32-27-24-12-10-21(30-24)16-19-8-7-18(28-19)15-20-9-11-22(29-20)26(17-5-3-2-4-6-17)23-13-14-25(27)31-23/h2-16,28,30H,1H3/b18-15-,19-16-,20-15-,21-16-,26-22-,26-23-,27-24+,27-25+.
What are the key properties of 10-methoxy-15-phenyl-21,22-dihydroporphyrin?
10-methoxy-15-phenyl-21,22-dihydroporphyrin has a molecular weight of 416.48 g/mol, XLogP of 6.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-15-phenyl-21,22-dihydroporphyrin is sourced from PubChem (CID 68578434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).