C18H21NO7 — CID 68578479
5-O-benzyl 7-O-ethyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate (PubChem CID 68578479) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-O-benzyl 7-O-ethyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate.
| Compound Name | 5-O-benzyl 7-O-ethyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
|---|---|
| PubChem CID | 68578479 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-O-benzyl 7-O-ethyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2OC[C@@H](C(=O)OC)N(C(=O)OCc3ccccc3)[C@H]21 |
| InChI | InChI=1S/C18H21NO7/c1-3-24-17(21)13-14-15(13)25-10-12(16(20)23-2)19(14)18(22)26-9-11-7-5-4-6-8-11/h4-8,12-15H,3,9-10H2,1-2H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | NFJYSRAYRYAFEW-ZQDZILKHSA-N |
| XLogP | 1.13 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|