C24H36N2O2S — CID 68579012
piperidin-1-yl-[4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]oxan-4-yl]methanone (PubChem CID 68579012) has the molecular formula C24H36N2O2S and a molecular weight of 416.63 g/mol. Its IUPAC name is piperidin-1-yl-[4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]oxan-4-yl]methanone.
| Compound Name | piperidin-1-yl-[4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]oxan-4-yl]methanone |
|---|---|
| PubChem CID | 68579012 |
| Molecular Formula | C24H36N2O2S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | piperidin-1-yl-[4-[4-(3-pyrrolidin-1-ylpropylsulfanyl)phenyl]oxan-4-yl]methanone |
| SMILES | O=C(N1CCCCC1)C1(c2ccc(SCCCN3CCCC3)cc2)CCOCC1 |
| InChI | InChI=1S/C24H36N2O2S/c27-23(26-16-2-1-3-17-26)24(11-18-28-19-12-24)21-7-9-22(10-8-21)29-20-6-15-25-13-4-5-14-25/h7-10H,1-6,11-20H2 |
| InChIKey | VPEUGRILNQWFAA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|