C20H25NO7 — CID 68579018
5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate (PubChem CID 68579018) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate.
| Compound Name | 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
|---|---|
| PubChem CID | 68579018 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-O-benzyl 7-O-tert-butyl 4-O-methyl (1R,4S,6S,7S)-2-oxa-5-azabicyclo[4.1.0]heptane-4,5,7-tricarboxylate |
| SMILES | COC(=O)[C@@H]1CO[C@@H]2[C@@H](C(=O)OC(C)(C)C)[C@@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25NO7/c1-20(2,3)28-18(23)14-15-16(14)26-11-13(17(22)25-4)21(15)19(24)27-10-12-8-6-5-7-9-12/h5-9,13-16H,10-11H2,1-4H3/t13-,14-,15-,16+/m0/s1 |
| InChIKey | AORJRGKPKSMPGA-YHUYYLMFSA-N |
| XLogP | 1.91 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|