C29H34N6O2 — CID 68579121
5-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 68579121) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 5-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68579121 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 5-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1cc(CN2CCN(c3cccc4[nH]c(-c5ccc(C(C)(C)C)cc5)nc34)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H34N6O2/c1-5-13-35-19-21(27(36)32-28(35)37)18-33-14-16-34(17-15-33)24-8-6-7-23-25(24)31-26(30-23)20-9-11-22(12-10-20)29(2,3)4/h5-12,19H,1,13-18H2,2-4H3,(H,30,31)(H,32,36,37) |
| InChIKey | QSGPTCMCTDQZHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|