C15H14N2O3 — CID 68579767
9-(4-nitrophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 68579767) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 9-(4-nitrophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 68579767 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 9-(4-nitrophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | O=[N+]([O-])c1ccc(-c2cccc3c2OCCNC3)cc1 |
| InChI | InChI=1S/C15H14N2O3/c18-17(19)13-6-4-11(5-7-13)14-3-1-2-12-10-16-8-9-20-15(12)14/h1-7,16H,8-10H2 |
| InChIKey | SPFBLMQQCRJLOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|