C33H36N6O2 — CID 68579779
4-cyclopentyl-7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1H-quinoxaline-2,3-dione (PubChem CID 68579779) has the molecular formula C33H36N6O2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 4-cyclopentyl-7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 4-cyclopentyl-7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 68579779 |
| Molecular Formula | C33H36N6O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 4-cyclopentyl-7-[[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-1H-quinoxaline-2,3-dione |
| SMILES | CCc1ccc(-c2nc3c(N4CCN(Cc5ccc6c(c5)[nH]c(=O)c(=O)n6C5CCCC5)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C33H36N6O2/c1-2-22-10-13-24(14-11-22)31-34-26-8-5-9-29(30(26)36-31)38-18-16-37(17-19-38)21-23-12-15-28-27(20-23)35-32(40)33(41)39(28)25-6-3-4-7-25/h5,8-15,20,25H,2-4,6-7,16-19,21H2,1H3,(H,34,36)(H,35,40) |
| InChIKey | DIQVPBVYPIFWNS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|