C31H29NO — CID 68580206
(3Z)-1-benzyl-3-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methylidene]indol-2-one (PubChem CID 68580206) has the molecular formula C31H29NO and a molecular weight of 431.58 g/mol. Its IUPAC name is (3Z)-1-benzyl-3-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methylidene]indol-2-one.
| Compound Name | (3Z)-1-benzyl-3-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methylidene]indol-2-one |
|---|---|
| PubChem CID | 68580206 |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (3Z)-1-benzyl-3-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methylidene]indol-2-one |
| SMILES | Cc1cc(/C=C2\C(=O)N(Cc3ccccc3)c3ccccc32)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C31H29NO/c1-20(2)24-15-14-21(3)30-25(16-22(4)27(30)17-24)18-28-26-12-8-9-13-29(26)32(31(28)33)19-23-10-6-5-7-11-23/h5-18,20H,19H2,1-4H3/b28-18- |
| InChIKey | WUDYBOJUUFNEJE-VEILYXNESA-N |
| XLogP | 7.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|