C14H17ClN2OS — CID 68580318
9-(2,4-dimethyl-1,3-thiazol-5-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride (PubChem CID 68580318) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 9-(2,4-dimethyl-1,3-thiazol-5-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride.
| Compound Name | 9-(2,4-dimethyl-1,3-thiazol-5-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride |
|---|---|
| PubChem CID | 68580318 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 9-(2,4-dimethyl-1,3-thiazol-5-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;hydrochloride |
| SMILES | Cc1nc(C)c(-c2cccc3c2OCCNC3)s1.Cl |
| InChI | InChI=1S/C14H16N2OS.ClH/c1-9-14(18-10(2)16-9)12-5-3-4-11-8-15-6-7-17-13(11)12;/h3-5,15H,6-8H2,1-2H3;1H |
| InChIKey | WNBJLVIKVJSXTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |