C28H28N2O4 — CID 68580764
N-[4-[[(2R,4aR,10aS)-2,7-dihydroxy-2-prop-1-ynyl-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]methyl]phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 68580764) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[4-[[(2R,4aR,10aS)-2,7-dihydroxy-2-prop-1-ynyl-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]methyl]phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-[[(2R,4aR,10aS)-2,7-dihydroxy-2-prop-1-ynyl-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]methyl]phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 68580764 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[4-[[(2R,4aR,10aS)-2,7-dihydroxy-2-prop-1-ynyl-1,3,4,9,10,10a-hexahydrophenanthren-4a-yl]methyl]phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | CC#C[C@@]1(O)CC[C@]2(Cc3ccc(NC(=O)c4ccno4)cc3)c3ccc(O)cc3CC[C@H]2C1 |
| InChI | InChI=1S/C28H28N2O4/c1-2-12-27(33)13-14-28(21(18-27)6-5-20-16-23(31)9-10-24(20)28)17-19-3-7-22(8-4-19)30-26(32)25-11-15-29-34-25/h3-4,7-11,15-16,21,31,33H,5-6,13-14,17-18H2,1H3,(H,30,32)/t21-,27+,28+/m0/s1 |
| InChIKey | UQYIAFYKHZBVMK-GJJMEYSYSA-N |
| XLogP | 4.61 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|