About ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate
ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate (PubChem CID 68580771) has the molecular formula C25H27N3O2
and a molecular weight of 401.51 g/mol. Its IUPAC name is ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 68580771 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Nc2ncc(-c3ccccc3)c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H27N3O2/c1-2-30-24(29)20-13-15-21(16-14-20)27-25-26-17-22(18-9-5-3-6-10-18)23(28-25)19-11-7-4-8-12-19/h3-12,17,20-21H,2,13-16H2,1H3,(H,26,27,28) |
| InChIKey | DUESRGOSJVTQCD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate (CID 68580771) is ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate is CCOC(=O)C1CCC(Nc2ncc(-c3ccccc3)c(-c3ccccc3)n2)CC1.
What is the InChIKey of ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate?
The InChIKey is DUESRGOSJVTQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O2/c1-2-30-24(29)20-13-15-21(16-14-20)27-25-26-17-22(18-9-5-3-6-10-18)23(28-25)19-11-7-4-8-12-19/h3-12,17,20-21H,2,13-16H2,1H3,(H,26,27,28).
What are the key properties of ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate?
ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate has a molecular weight of 401.51 g/mol, XLogP of 5.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(4,5-diphenylpyrimidin-2-yl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 68580771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).