C10H11F7O2 — CID 6858136
(Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one (PubChem CID 6858136) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is (Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one.
| Compound Name | (Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one |
|---|---|
| PubChem CID | 6858136 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one |
| SMILES | CC(C)(C)/C(O)=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4,18H,1-3H3/b5-4- |
| InChIKey | GCTMXWUUEYFTEL-PLNGDYQASA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|