About 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane
1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane (PubChem CID 68581561) has the molecular formula C24H48O3
and a molecular weight of 384.65 g/mol. Its IUPAC name is 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane.
Molecular Properties
| Compound Name | 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane |
| PubChem CID | 68581561 |
| Molecular Formula | C24H48O3 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane |
| SMILES | C1COCOC1.CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC |
| InChI | InChI=1S/C20H40O.C4H8O2/c1-3-5-7-9-11-13-17-20-19(16-14-18-21-20)15-12-10-8-6-4-2;1-2-5-4-6-3-1/h19-20H,3-18H2,1-2H3;1-4H2/t19-,20+;/m0./s1 |
| InChIKey | GCYHIJSKROXMKP-CMXBXVFLSA-N |
| XLogP | 7.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane?
The IUPAC name of 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane (CID 68581561) is 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane.
What is the SMILES notation for 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane?
The canonical SMILES for 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane is C1COCOC1.CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC.
What is the InChIKey of 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane?
The InChIKey is GCYHIJSKROXMKP-CMXBXVFLSA-N. The full InChI is InChI=1S/C20H40O.C4H8O2/c1-3-5-7-9-11-13-17-20-19(16-14-18-21-20)15-12-10-8-6-4-2;1-2-5-4-6-3-1/h19-20H,3-18H2,1-2H3;1-4H2/t19-,20+;/m0./s1.
What are the key properties of 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane?
1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane has a molecular weight of 384.65 g/mol, XLogP of 7.27, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxane;(2R,3S)-3-heptyl-2-octyloxane is sourced from PubChem (CID 68581561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).