C17H22O2 — CID 68581610
(4aR,10aS)-7-hydroxy-4a-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one (PubChem CID 68581610) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4aR,10aS)-7-hydroxy-4a-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one.
| Compound Name | (4aR,10aS)-7-hydroxy-4a-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 68581610 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4aR,10aS)-7-hydroxy-4a-propyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
| SMILES | CCC[C@@]12CCC(=O)C[C@@H]1CCc1cc(O)ccc12 |
| InChI | InChI=1S/C17H22O2/c1-2-8-17-9-7-15(19)11-13(17)4-3-12-10-14(18)5-6-16(12)17/h5-6,10,13,18H,2-4,7-9,11H2,1H3/t13-,17+/m0/s1 |
| InChIKey | QUCFOZYANMEGCO-SUMWQHHRSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |