C31H31N9O2S — CID 68581701
4-N-(1H-indazol-6-yl)-7-(4-methylphenyl)sulfonyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 68581701) has the molecular formula C31H31N9O2S and a molecular weight of 593.72 g/mol. Its IUPAC name is 4-N-(1H-indazol-6-yl)-7-(4-methylphenyl)sulfonyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1H-indazol-6-yl)-7-(4-methylphenyl)sulfonyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68581701 |
| Molecular Formula | C31H31N9O2S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 4-N-(1H-indazol-6-yl)-7-(4-methylphenyl)sulfonyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(Nc4ccc5cn[nH]c5c4)nc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C31H31N9O2S/c1-21-3-11-26(12-4-21)43(41,42)40-14-13-27-29(33-24-6-5-22-20-32-37-28(22)19-24)35-31(36-30(27)40)34-23-7-9-25(10-8-23)39-17-15-38(2)16-18-39/h3-14,19-20H,15-18H2,1-2H3,(H,32,37)(H2,33,34,35,36) |
| InChIKey | WRRYIKQCCMXBFS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|