C24H29N7OS — CID 68581896
N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-methylsulfanylbenzamide (PubChem CID 68581896) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-methylsulfanylbenzamide.
| Compound Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 68581896 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)Nc1nc(N[C@H]2CCCCC2N=C(N)N)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C24H29N7OS/c1-14-11-12-17-16(13-14)21(27-18-8-4-5-9-19(18)28-23(25)26)30-24(29-17)31-22(32)15-7-3-6-10-20(15)33-2/h3,6-7,10-13,18-19H,4-5,8-9H2,1-2H3,(H4,25,26,28)(H2,27,29,30,31,32)/t18-,19?/m0/s1 |
| InChIKey | BQNAAYQKHHDNRK-OYKVQYDMSA-N |
| XLogP | 3.91 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|