C14H18O2 — CID 68581949
4-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)benzene-1,2-diol (PubChem CID 68581949) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)benzene-1,2-diol.
| Compound Name | 4-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 68581949 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-(2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(C23CCCC2CCC3)cc1O |
| InChI | InChI=1S/C14H18O2/c15-12-6-5-11(9-13(12)16)14-7-1-3-10(14)4-2-8-14/h5-6,9-10,15-16H,1-4,7-8H2 |
| InChIKey | JVZVWLZKQFNLSP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|