C25H33Cl2N7O — CID 68582222
N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-4-ethylbenzamide;dihydrochloride (PubChem CID 68582222) has the molecular formula C25H33Cl2N7O and a molecular weight of 518.49 g/mol. Its IUPAC name is N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-4-ethylbenzamide;dihydrochloride.
| Compound Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-4-ethylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 68582222 |
| Molecular Formula | C25H33Cl2N7O |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-4-ethylbenzamide;dihydrochloride |
| SMILES | CCc1ccc(C(=O)Nc2nc(N[C@H]3CCCC[C@H]3N=C(N)N)c3cc(C)ccc3n2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H31N7O.2ClH/c1-3-16-9-11-17(12-10-16)23(33)32-25-30-19-13-8-15(2)14-18(19)22(31-25)28-20-6-4-5-7-21(20)29-24(26)27;;/h8-14,20-21H,3-7H2,1-2H3,(H4,26,27,29)(H2,28,30,31,32,33);2*1H/t20-,21+;;/m0../s1 |
| InChIKey | AEVPSGUMRHZWEG-DDZPGPNZSA-N |
| XLogP | 4.59 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|