C17H18O2 — CID 68582364
spiro[1,2-dihydroindene-3,3'-2,3a-dihydro-1H-indene]-4',4'-diol (PubChem CID 68582364) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,3'-2,3a-dihydro-1H-indene]-4',4'-diol.
| Compound Name | spiro[1,2-dihydroindene-3,3'-2,3a-dihydro-1H-indene]-4',4'-diol |
|---|---|
| PubChem CID | 68582364 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | spiro[1,2-dihydroindene-3,3'-2,3a-dihydro-1H-indene]-4',4'-diol |
| SMILES | OC1(O)C=CC=C2CCC3(CCc4ccccc43)C21 |
| InChI | InChI=1S/C17H18O2/c18-17(19)9-3-5-13-8-11-16(15(13)17)10-7-12-4-1-2-6-14(12)16/h1-6,9,15,18-19H,7-8,10-11H2 |
| InChIKey | ORDVGZHQNLSBLG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|