About (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine
(4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine (PubChem CID 68582558) has the molecular formula C8H8N2S2
and a molecular weight of 196.30 g/mol. Its IUPAC name is (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine |
| PubChem CID | 68582558 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine |
| SMILES | NCc1scnc1-c1ccsc1 |
| InChI | InChI=1S/C8H8N2S2/c9-3-7-8(10-5-12-7)6-1-2-11-4-6/h1-2,4-5H,3,9H2 |
| InChIKey | LZEFEQFSGYPJSG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine?
The IUPAC name of (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine (CID 68582558) is (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine?
The canonical SMILES for (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine is NCc1scnc1-c1ccsc1.
What is the InChIKey of (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine?
The InChIKey is LZEFEQFSGYPJSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S2/c9-3-7-8(10-5-12-7)6-1-2-11-4-6/h1-2,4-5H,3,9H2.
What are the key properties of (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine?
(4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine has a molecular weight of 196.30 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-thiophen-3-yl-1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 68582558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).