About 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid
2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid (PubChem CID 68583044) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid |
| PubChem CID | 68583044 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H18O3/c1-10(2,9(12)13)7-5-3-4-6-8(7)11/h7-8,11H,3-6H2,1-2H3,(H,12,13)/t7-,8-/m1/s1 |
| InChIKey | CLPVJMOLAVNSHJ-HTQZYQBOSA-N |
| XLogP | 1.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid?
The IUPAC name of 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid (CID 68583044) is 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid.
What is the SMILES notation for 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid?
The canonical SMILES for 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid is CC(C)(C(=O)O)[C@@H]1CCCC[C@H]1O.
What is the InChIKey of 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid?
The InChIKey is CLPVJMOLAVNSHJ-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H18O3/c1-10(2,9(12)13)7-5-3-4-6-8(7)11/h7-8,11H,3-6H2,1-2H3,(H,12,13)/t7-,8-/m1/s1.
What are the key properties of 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid?
2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid has a molecular weight of 186.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-hydroxycyclohexyl]-2-methylpropanoic acid is sourced from PubChem (CID 68583044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).