C16H20ClNO4 — CID 68583156
1-(4-chlorobutyl)-7,8-dimethoxy-3,4-dihydro-1-benzazepine-2,5-dione (PubChem CID 68583156) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 1-(4-chlorobutyl)-7,8-dimethoxy-3,4-dihydro-1-benzazepine-2,5-dione.
| Compound Name | 1-(4-chlorobutyl)-7,8-dimethoxy-3,4-dihydro-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 68583156 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-(4-chlorobutyl)-7,8-dimethoxy-3,4-dihydro-1-benzazepine-2,5-dione |
| SMILES | COc1cc2c(cc1OC)N(CCCCCl)C(=O)CCC2=O |
| InChI | InChI=1S/C16H20ClNO4/c1-21-14-9-11-12(10-15(14)22-2)18(8-4-3-7-17)16(20)6-5-13(11)19/h9-10H,3-8H2,1-2H3 |
| InChIKey | WZZLEVWOYMRMBJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|